C19H17F2NO5 — CID 26206675
diethyl 5-[(3,5-difluorobenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 26206675) has the molecular formula C19H17F2NO5 and a molecular weight of 377.34 g/mol. Its IUPAC name is diethyl 5-[(3,5-difluorobenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[(3,5-difluorobenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 26206675 |
| Molecular Formula | C19H17F2NO5 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | diethyl 5-[(3,5-difluorobenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2cc(F)cc(F)c2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C19H17F2NO5/c1-3-26-18(24)12-5-13(19(25)27-4-2)9-16(8-12)22-17(23)11-6-14(20)10-15(21)7-11/h5-10H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | PVYGZNFNSDNXTM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |