C15H12F4N2O3 — CID 166482851
ethyl 4-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-1H-pyrrole-2-carboxylate (PubChem CID 166482851) has the molecular formula C15H12F4N2O3 and a molecular weight of 344.26 g/mol. Its IUPAC name is ethyl 4-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166482851 |
| Molecular Formula | C15H12F4N2O3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | ethyl 4-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2cc(F)cc(C(F)(F)F)c2)c[nH]1 |
| InChI | InChI=1S/C15H12F4N2O3/c1-2-24-14(23)12-6-11(7-20-12)21-13(22)8-3-9(15(17,18)19)5-10(16)4-8/h3-7,20H,2H2,1H3,(H,21,22) |
| InChIKey | BHQSIKLZJYFFLY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |