C11H18N4O2 — CID 53499685
1-(5-methyl-1,2-oxazol-3-yl)-3-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 53499685) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(5-methyl-1,2-oxazol-3-yl)-3-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 53499685 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-(5-methyl-1,2-oxazol-3-yl)-3-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | Cc1cc(NC(=O)NCCN2CCCC2)no1 |
| InChI | InChI=1S/C11H18N4O2/c1-9-8-10(14-17-9)13-11(16)12-4-7-15-5-2-3-6-15/h8H,2-7H2,1H3,(H2,12,13,14,16) |
| InChIKey | HOAMYHVJRCJYCN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |