C20H19F5N4O2 — CID 143265421
1-(2,4-difluorophenyl)-3-[3-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]-4-(trifluoromethoxy)phenyl]urea (PubChem CID 143265421) has the molecular formula C20H19F5N4O2 and a molecular weight of 442.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[3-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]-4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[3-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]-4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 143265421 |
| Molecular Formula | C20H19F5N4O2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[3-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]-4-(trifluoromethoxy)phenyl]urea |
| SMILES | C/C=N\N(C)/C(=C\C)c1cc(NC(=O)Nc2ccc(F)cc2F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C20H19F5N4O2/c1-4-17(29(3)26-5-2)14-11-13(7-9-18(14)31-20(23,24)25)27-19(30)28-16-8-6-12(21)10-15(16)22/h4-11H,1-3H3,(H2,27,28,30)/b17-4-,26-5- |
| InChIKey | CCBMVJQSDSMSLO-HKGNSGDISA-N |
| XLogP | 5.81 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|