C18H16ClFN4O2 — CID 11545269
1-[3-(4-chloro-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(2-fluorophenyl)urea (PubChem CID 11545269) has the molecular formula C18H16ClFN4O2 and a molecular weight of 374.80 g/mol. Its IUPAC name is 1-[3-(4-chloro-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[3-(4-chloro-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 11545269 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-[3-(4-chloro-1-methylpyrazol-5-yl)-4-methoxyphenyl]-3-(2-fluorophenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccccc2F)cc1-c1c(Cl)cnn1C |
| InChI | InChI=1S/C18H16ClFN4O2/c1-24-17(13(19)10-21-24)12-9-11(7-8-16(12)26-2)22-18(25)23-15-6-4-3-5-14(15)20/h3-10H,1-2H3,(H2,22,23,25) |
| InChIKey | LOFJTRNMHRVUQZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |