C15H22N4OS — CID 103420799
3-amino-4-cyano-5-[ethyl(2-methylpropyl)amino]-N-prop-2-enylthiophene-2-carboxamide (PubChem CID 103420799) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 3-amino-4-cyano-5-[ethyl(2-methylpropyl)amino]-N-prop-2-enylthiophene-2-carboxamide.
| Compound Name | 3-amino-4-cyano-5-[ethyl(2-methylpropyl)amino]-N-prop-2-enylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420799 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-amino-4-cyano-5-[ethyl(2-methylpropyl)amino]-N-prop-2-enylthiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc(N(CC)CC(C)C)c(C#N)c1N |
| InChI | InChI=1S/C15H22N4OS/c1-5-7-18-14(20)13-12(17)11(8-16)15(21-13)19(6-2)9-10(3)4/h5,10H,1,6-7,9,17H2,2-4H3,(H,18,20) |
| InChIKey | LVYLURLSTYTFIV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|