C13H23N3O3S2 — CID 103419201
3-amino-5-(diethylamino)-N-ethyl-4-ethylsulfonylthiophene-2-carboxamide (PubChem CID 103419201) has the molecular formula C13H23N3O3S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-amino-5-(diethylamino)-N-ethyl-4-ethylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(diethylamino)-N-ethyl-4-ethylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103419201 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-amino-5-(diethylamino)-N-ethyl-4-ethylsulfonylthiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(N(CC)CC)c(S(=O)(=O)CC)c1N |
| InChI | InChI=1S/C13H23N3O3S2/c1-5-15-12(17)10-9(14)11(21(18,19)8-4)13(20-10)16(6-2)7-3/h5-8,14H2,1-4H3,(H,15,17) |
| InChIKey | QZHVCADPNILGRO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |