C9H15N3O3S2 — CID 103420203
3-amino-5-(dimethylamino)-4-ethylsulfonylthiophene-2-carboxamide (PubChem CID 103420203) has the molecular formula C9H15N3O3S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-amino-5-(dimethylamino)-4-ethylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(dimethylamino)-4-ethylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420203 |
| Molecular Formula | C9H15N3O3S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3-amino-5-(dimethylamino)-4-ethylsulfonylthiophene-2-carboxamide |
| SMILES | CCS(=O)(=O)c1c(N(C)C)sc(C(N)=O)c1N |
| InChI | InChI=1S/C9H15N3O3S2/c1-4-17(14,15)7-5(10)6(8(11)13)16-9(7)12(2)3/h4,10H2,1-3H3,(H2,11,13) |
| InChIKey | DZBIDPDVORNGCQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |