C9H14N2O4S2 — CID 103420197
methyl 3-amino-5-(dimethylamino)-4-methylsulfonylthiophene-2-carboxylate (PubChem CID 103420197) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is methyl 3-amino-5-(dimethylamino)-4-methylsulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-(dimethylamino)-4-methylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 103420197 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | methyl 3-amino-5-(dimethylamino)-4-methylsulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(N(C)C)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C9H14N2O4S2/c1-11(2)8-7(17(4,13)14)5(10)6(16-8)9(12)15-3/h10H2,1-4H3 |
| InChIKey | MKFMZYAXRVTINW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |