C12H18N2O3S — CID 103420280
methyl 4-amino-2-(dimethylamino)-5-(2-methylpropanoyl)thiophene-3-carboxylate (PubChem CID 103420280) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is methyl 4-amino-2-(dimethylamino)-5-(2-methylpropanoyl)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-2-(dimethylamino)-5-(2-methylpropanoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103420280 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | methyl 4-amino-2-(dimethylamino)-5-(2-methylpropanoyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N(C)C)sc(C(=O)C(C)C)c1N |
| InChI | InChI=1S/C12H18N2O3S/c1-6(2)9(15)10-8(13)7(12(16)17-5)11(18-10)14(3)4/h6H,13H2,1-5H3 |
| InChIKey | LWVDDBZARPZCED-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |