C11H15F2N3OS2 — CID 103505802
3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide (PubChem CID 103505802) has the molecular formula C11H15F2N3OS2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103505802 |
| Molecular Formula | C11H15F2N3OS2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanyl-N-prop-2-enylthiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1sc(NCC(F)F)c(SC)c1N |
| InChI | InChI=1S/C11H15F2N3OS2/c1-3-4-15-10(17)8-7(14)9(18-2)11(19-8)16-5-6(12)13/h3,6,16H,1,4-5,14H2,2H3,(H,15,17) |
| InChIKey | WGKNYAVZEKURJU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|