About 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide
3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103505688) has the molecular formula C8H11F2N3OS2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide |
| PubChem CID | 103505688 |
| Molecular Formula | C8H11F2N3OS2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(NCC(F)F)sc(C(N)=O)c1N |
| InChI | InChI=1S/C8H11F2N3OS2/c1-15-6-4(11)5(7(12)14)16-8(6)13-2-3(9)10/h3,13H,2,11H2,1H3,(H2,12,14) |
| InChIKey | GHGBVFRXDDADBK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide?
The IUPAC name of 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide (CID 103505688) is 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide.
What is the SMILES notation for 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide?
The canonical SMILES for 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide is CSc1c(NCC(F)F)sc(C(N)=O)c1N.
What is the InChIKey of 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide?
The InChIKey is GHGBVFRXDDADBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3OS2/c1-15-6-4(11)5(7(12)14)16-8(6)13-2-3(9)10/h3,13H,2,11H2,1H3,(H2,12,14).
What are the key properties of 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide?
3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide has a molecular weight of 267.33 g/mol, XLogP of 1.83, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(2,2-difluoroethylamino)-4-methylsulfanylthiophene-2-carboxamide is sourced from PubChem (CID 103505688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).