C11H17N3OS2 — CID 103427551
3-amino-5-(1-cyclopropylethylamino)-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103427551) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 3-amino-5-(1-cyclopropylethylamino)-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(1-cyclopropylethylamino)-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103427551 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-amino-5-(1-cyclopropylethylamino)-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(NC(C)C2CC2)sc(C(N)=O)c1N |
| InChI | InChI=1S/C11H17N3OS2/c1-5(6-3-4-6)14-11-9(16-2)7(12)8(17-11)10(13)15/h5-6,14H,3-4,12H2,1-2H3,(H2,13,15) |
| InChIKey | RCZYNKOCYBJJOE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |