C13H14ClN3OS2 — CID 103425470
3-amino-5-[(2-chlorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide (PubChem CID 103425470) has the molecular formula C13H14ClN3OS2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 3-amino-5-[(2-chlorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(2-chlorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103425470 |
| Molecular Formula | C13H14ClN3OS2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-amino-5-[(2-chlorophenyl)methylamino]-4-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1c(NCc2ccccc2Cl)sc(C(N)=O)c1N |
| InChI | InChI=1S/C13H14ClN3OS2/c1-19-11-9(15)10(12(16)18)20-13(11)17-6-7-4-2-3-5-8(7)14/h2-5,17H,6,15H2,1H3,(H2,16,18) |
| InChIKey | ADKVWAAVGADLSN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |