C10H15NO3S3 — CID 103526645
1-(3-amino-4-ethylsulfonyl-5-methylsulfanylthiophen-2-yl)propan-1-one (PubChem CID 103526645) has the molecular formula C10H15NO3S3 and a molecular weight of 293.44 g/mol. Its IUPAC name is 1-(3-amino-4-ethylsulfonyl-5-methylsulfanylthiophen-2-yl)propan-1-one.
| Compound Name | 1-(3-amino-4-ethylsulfonyl-5-methylsulfanylthiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 103526645 |
| Molecular Formula | C10H15NO3S3 |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 1-(3-amino-4-ethylsulfonyl-5-methylsulfanylthiophen-2-yl)propan-1-one |
| SMILES | CCC(=O)c1sc(SC)c(S(=O)(=O)CC)c1N |
| InChI | InChI=1S/C10H15NO3S3/c1-4-6(12)8-7(11)9(10(15-3)16-8)17(13,14)5-2/h4-5,11H2,1-3H3 |
| InChIKey | BGNPGAKDRLAJTL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |