About 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one
1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one (PubChem CID 103505677) has the molecular formula C11H16F2N2O3S2
and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one |
| PubChem CID | 103505677 |
| Molecular Formula | C11H16F2N2O3S2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(NCC(F)F)c(S(=O)(=O)CC)c1N |
| InChI | InChI=1S/C11H16F2N2O3S2/c1-3-6(16)9-8(14)10(20(17,18)4-2)11(19-9)15-5-7(12)13/h7,15H,3-5,14H2,1-2H3 |
| InChIKey | AXQKWVBPNUUYHD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one?
The IUPAC name of 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one (CID 103505677) is 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one.
What is the SMILES notation for 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one?
The canonical SMILES for 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one is CCC(=O)c1sc(NCC(F)F)c(S(=O)(=O)CC)c1N.
What is the InChIKey of 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one?
The InChIKey is AXQKWVBPNUUYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N2O3S2/c1-3-6(16)9-8(14)10(20(17,18)4-2)11(19-9)15-5-7(12)13/h7,15H,3-5,14H2,1-2H3.
What are the key properties of 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one?
1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one has a molecular weight of 326.39 g/mol, XLogP of 2.39, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-amino-5-(2,2-difluoroethylamino)-4-ethylsulfonylthiophen-2-yl]propan-1-one is sourced from PubChem (CID 103505677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).