C12H19N3O3S2 — CID 103507351
3-amino-4-ethylsulfonyl-N-methyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide (PubChem CID 103507351) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 3-amino-4-ethylsulfonyl-N-methyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-4-ethylsulfonyl-N-methyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103507351 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-amino-4-ethylsulfonyl-N-methyl-5-(2-methylprop-2-enylamino)thiophene-2-carboxamide |
| SMILES | C=C(C)CNc1sc(C(=O)NC)c(N)c1S(=O)(=O)CC |
| InChI | InChI=1S/C12H19N3O3S2/c1-5-20(17,18)10-8(13)9(11(16)14-4)19-12(10)15-6-7(2)3/h15H,2,5-6,13H2,1,3-4H3,(H,14,16) |
| InChIKey | NHFRZLUJBTULTD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|