C14H22N2OS2 — CID 103420433
[3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]-cyclopropylmethanone (PubChem CID 103420433) has the molecular formula C14H22N2OS2 and a molecular weight of 298.48 g/mol. Its IUPAC name is [3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]-cyclopropylmethanone.
| Compound Name | [3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 103420433 |
| Molecular Formula | C14H22N2OS2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [3-amino-5-[butyl(methyl)amino]-4-methylsulfanylthiophen-2-yl]-cyclopropylmethanone |
| SMILES | CCCCN(C)c1sc(C(=O)C2CC2)c(N)c1SC |
| InChI | InChI=1S/C14H22N2OS2/c1-4-5-8-16(2)14-13(18-3)10(15)12(19-14)11(17)9-6-7-9/h9H,4-8,15H2,1-3H3 |
| InChIKey | QJAQHTZBFNCZKX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |