C14H11Br2FN2O — CID 61466855
3-[(2,5-dibromoanilino)methyl]-4-fluorobenzamide (PubChem CID 61466855) has the molecular formula C14H11Br2FN2O and a molecular weight of 402.06 g/mol. Its IUPAC name is 3-[(2,5-dibromoanilino)methyl]-4-fluorobenzamide.
| Compound Name | 3-[(2,5-dibromoanilino)methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 61466855 |
| Molecular Formula | C14H11Br2FN2O |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 3-[(2,5-dibromoanilino)methyl]-4-fluorobenzamide |
| SMILES | NC(=O)c1ccc(F)c(CNc2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C14H11Br2FN2O/c15-10-2-3-11(16)13(6-10)19-7-9-5-8(14(18)20)1-4-12(9)17/h1-6,19H,7H2,(H2,18,20) |
| InChIKey | NEUUHJNTHLFLDO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |