C11H15F3N2OS2 — CID 103505961
1-[3-amino-4-methylsulfanyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]ethanone (PubChem CID 103505961) has the molecular formula C11H15F3N2OS2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[3-amino-4-methylsulfanyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-4-methylsulfanyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103505961 |
| Molecular Formula | C11H15F3N2OS2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-[3-amino-4-methylsulfanyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]ethanone |
| SMILES | CSc1c(NCCCC(F)(F)F)sc(C(C)=O)c1N |
| InChI | InChI=1S/C11H15F3N2OS2/c1-6(17)8-7(15)9(18-2)10(19-8)16-5-3-4-11(12,13)14/h16H,3-5,15H2,1-2H3 |
| InChIKey | BSHCEIJKCNHYJS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|