C12H21N3O3S2 — CID 103506973
1-[3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophen-2-yl]ethanone (PubChem CID 103506973) has the molecular formula C12H21N3O3S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-[3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103506973 |
| Molecular Formula | C12H21N3O3S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-[3-amino-5-[2-(dimethylamino)propylamino]-4-methylsulfonylthiophen-2-yl]ethanone |
| SMILES | CC(=O)c1sc(NCC(C)N(C)C)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C12H21N3O3S2/c1-7(15(3)4)6-14-12-11(20(5,17)18)9(13)10(19-12)8(2)16/h7,14H,6,13H2,1-5H3 |
| InChIKey | SLQLXOVFBSYKML-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |