C12H21N3O3S — CID 103506972
methyl 3-amino-5-[2-(dimethylamino)propylamino]-4-methoxythiophene-2-carboxylate (PubChem CID 103506972) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is methyl 3-amino-5-[2-(dimethylamino)propylamino]-4-methoxythiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-[2-(dimethylamino)propylamino]-4-methoxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 103506972 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | methyl 3-amino-5-[2-(dimethylamino)propylamino]-4-methoxythiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NCC(C)N(C)C)c(OC)c1N |
| InChI | InChI=1S/C12H21N3O3S/c1-7(15(2)3)6-14-11-9(17-4)8(13)10(19-11)12(16)18-5/h7,14H,6,13H2,1-5H3 |
| InChIKey | FDTFDGJXHWWOOG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |