C15H25N3O2S — CID 103506893
ethyl 3-amino-4-cyclopropyl-5-[2-(dimethylamino)propylamino]thiophene-2-carboxylate (PubChem CID 103506893) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is ethyl 3-amino-4-cyclopropyl-5-[2-(dimethylamino)propylamino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-cyclopropyl-5-[2-(dimethylamino)propylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103506893 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethyl 3-amino-4-cyclopropyl-5-[2-(dimethylamino)propylamino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NCC(C)N(C)C)c(C2CC2)c1N |
| InChI | InChI=1S/C15H25N3O2S/c1-5-20-15(19)13-12(16)11(10-6-7-10)14(21-13)17-8-9(2)18(3)4/h9-10,17H,5-8,16H2,1-4H3 |
| InChIKey | UOMUTTVHOQMDFN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |