C10H16N2O4S — CID 103423455
methyl 3-amino-4-methoxy-5-(2-methoxyethylamino)thiophene-2-carboxylate (PubChem CID 103423455) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is methyl 3-amino-4-methoxy-5-(2-methoxyethylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-methoxy-5-(2-methoxyethylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103423455 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | methyl 3-amino-4-methoxy-5-(2-methoxyethylamino)thiophene-2-carboxylate |
| SMILES | COCCNc1sc(C(=O)OC)c(N)c1OC |
| InChI | InChI=1S/C10H16N2O4S/c1-14-5-4-12-9-7(15-2)6(11)8(17-9)10(13)16-3/h12H,4-5,11H2,1-3H3 |
| InChIKey | UUVCRLAMYNTUGY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|