C11H19N3O4S2 — CID 103432214
3-amino-N-ethyl-4-methoxy-5-(2-methylsulfonylethylamino)thiophene-2-carboxamide (PubChem CID 103432214) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-amino-N-ethyl-4-methoxy-5-(2-methylsulfonylethylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-ethyl-4-methoxy-5-(2-methylsulfonylethylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103432214 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-amino-N-ethyl-4-methoxy-5-(2-methylsulfonylethylamino)thiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(NCCS(C)(=O)=O)c(OC)c1N |
| InChI | InChI=1S/C11H19N3O4S2/c1-4-13-10(15)9-7(12)8(18-2)11(19-9)14-5-6-20(3,16)17/h14H,4-6,12H2,1-3H3,(H,13,15) |
| InChIKey | CXGOBANQHGAGTC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |