C14H24N2OSi — CID 18630068
5-(dimethylamino)-N-ethyl-2-trimethylsilylbenzamide (PubChem CID 18630068) has the molecular formula C14H24N2OSi and a molecular weight of 264.44 g/mol. Its IUPAC name is 5-(dimethylamino)-N-ethyl-2-trimethylsilylbenzamide.
| Compound Name | 5-(dimethylamino)-N-ethyl-2-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 18630068 |
| Molecular Formula | C14H24N2OSi |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-(dimethylamino)-N-ethyl-2-trimethylsilylbenzamide |
| SMILES | CCNC(=O)c1cc(N(C)C)ccc1[Si](C)(C)C |
| InChI | InChI=1S/C14H24N2OSi/c1-7-15-14(17)12-10-11(16(2)3)8-9-13(12)18(4,5)6/h8-10H,7H2,1-6H3,(H,15,17) |
| InChIKey | JJXRRZIEKUPALG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|