C11H19N3OS — CID 88654343
4-N,4-N-dimethylbenzene-1,4-diamine;ethylcarbamothioic S-acid (PubChem CID 88654343) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-N,4-N-dimethylbenzene-1,4-diamine;ethylcarbamothioic S-acid.
| Compound Name | 4-N,4-N-dimethylbenzene-1,4-diamine;ethylcarbamothioic S-acid |
|---|---|
| PubChem CID | 88654343 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-N,4-N-dimethylbenzene-1,4-diamine;ethylcarbamothioic S-acid |
| SMILES | CCNC(=O)S.CN(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C8H12N2.C3H7NOS/c1-10(2)8-5-3-7(9)4-6-8;1-2-4-3(5)6/h3-6H,9H2,1-2H3;2H2,1H3,(H2,4,5,6) |
| InChIKey | NANXNHOQAHMSRW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|