C14H23N3O — CID 55174400
2-(4-amino-N-propylanilino)-N-propylacetamide (PubChem CID 55174400) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(4-amino-N-propylanilino)-N-propylacetamide.
| Compound Name | 2-(4-amino-N-propylanilino)-N-propylacetamide |
|---|---|
| PubChem CID | 55174400 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-(4-amino-N-propylanilino)-N-propylacetamide |
| SMILES | CCCNC(=O)CN(CCC)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H23N3O/c1-3-9-16-14(18)11-17(10-4-2)13-7-5-12(15)6-8-13/h5-8H,3-4,9-11,15H2,1-2H3,(H,16,18) |
| InChIKey | WDEXWZOHTXGMPW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|