C16H26ClN3O2 — CID 119741239
2-(4-aminophenyl)-N-[2-oxo-2-(propylamino)ethyl]-N-propylacetamide;hydrochloride (PubChem CID 119741239) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[2-oxo-2-(propylamino)ethyl]-N-propylacetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[2-oxo-2-(propylamino)ethyl]-N-propylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119741239 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-(4-aminophenyl)-N-[2-oxo-2-(propylamino)ethyl]-N-propylacetamide;hydrochloride |
| SMILES | CCCNC(=O)CN(CCC)C(=O)Cc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C16H25N3O2.ClH/c1-3-9-18-15(20)12-19(10-4-2)16(21)11-13-5-7-14(17)8-6-13;/h5-8H,3-4,9-12,17H2,1-2H3,(H,18,20);1H |
| InChIKey | KYNVOZPXUJRKEI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|