C13H24N4OS — CID 103508810
3-amino-5-[[2-(dimethylamino)-2-methylpropyl]amino]-N-ethylthiophene-2-carboxamide (PubChem CID 103508810) has the molecular formula C13H24N4OS and a molecular weight of 284.43 g/mol. Its IUPAC name is 3-amino-5-[[2-(dimethylamino)-2-methylpropyl]amino]-N-ethylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[[2-(dimethylamino)-2-methylpropyl]amino]-N-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103508810 |
| Molecular Formula | C13H24N4OS |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-amino-5-[[2-(dimethylamino)-2-methylpropyl]amino]-N-ethylthiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(NCC(C)(C)N(C)C)cc1N |
| InChI | InChI=1S/C13H24N4OS/c1-6-15-12(18)11-9(14)7-10(19-11)16-8-13(2,3)17(4)5/h7,16H,6,8,14H2,1-5H3,(H,15,18) |
| InChIKey | DZJHVQYPKOGSTM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |