C11H14F3N3OS — CID 106219029
3-amino-N-ethyl-5-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-2-carboxamide (PubChem CID 106219029) has the molecular formula C11H14F3N3OS and a molecular weight of 293.31 g/mol. Its IUPAC name is 3-amino-N-ethyl-5-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-2-carboxamide.
| Compound Name | 3-amino-N-ethyl-5-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106219029 |
| Molecular Formula | C11H14F3N3OS |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-amino-N-ethyl-5-[[1-(trifluoromethyl)cyclopropyl]amino]thiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(NC2(C(F)(F)F)CC2)cc1N |
| InChI | InChI=1S/C11H14F3N3OS/c1-2-16-9(18)8-6(15)5-7(19-8)17-10(3-4-10)11(12,13)14/h5,17H,2-4,15H2,1H3,(H,16,18) |
| InChIKey | MOMXZPBVXNEHRK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |