C6H7ClN2OS — CID 127003282
3-chloro-N-ethyl-1,2-thiazole-5-carboxamide (PubChem CID 127003282) has the molecular formula C6H7ClN2OS and a molecular weight of 190.66 g/mol. Its IUPAC name is 3-chloro-N-ethyl-1,2-thiazole-5-carboxamide.
| Compound Name | 3-chloro-N-ethyl-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 127003282 |
| Molecular Formula | C6H7ClN2OS |
| Molecular Weight | 190.66 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 3-chloro-N-ethyl-1,2-thiazole-5-carboxamide |
| SMILES | CCNC(=O)c1cc(Cl)ns1 |
| InChI | InChI=1S/C6H7ClN2OS/c1-2-8-6(10)4-3-5(7)9-11-4/h3H,2H2,1H3,(H,8,10) |
| InChIKey | JEQLRAFCBXHHKZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.66 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |