C6H7ClN2O2S — CID 130804739
3-chloro-N-(2-hydroxyethyl)-1,2-thiazole-5-carboxamide (PubChem CID 130804739) has the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxyethyl)-1,2-thiazole-5-carboxamide.
| Compound Name | 3-chloro-N-(2-hydroxyethyl)-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130804739 |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 3-chloro-N-(2-hydroxyethyl)-1,2-thiazole-5-carboxamide |
| SMILES | O=C(NCCO)c1cc(Cl)ns1 |
| InChI | InChI=1S/C6H7ClN2O2S/c7-5-3-4(12-9-5)6(11)8-1-2-10/h3,10H,1-2H2,(H,8,11) |
| InChIKey | ADUFOALWVIORNG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |