C7H7Cl2N3O2 — CID 43501013
3,6-dichloro-N-(2-hydroxyethyl)pyridazine-4-carboxamide (PubChem CID 43501013) has the molecular formula C7H7Cl2N3O2 and a molecular weight of 236.06 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-hydroxyethyl)pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-(2-hydroxyethyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 43501013 |
| Molecular Formula | C7H7Cl2N3O2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 3,6-dichloro-N-(2-hydroxyethyl)pyridazine-4-carboxamide |
| SMILES | O=C(NCCO)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C7H7Cl2N3O2/c8-5-3-4(6(9)12-11-5)7(14)10-1-2-13/h3,13H,1-2H2,(H,10,14) |
| InChIKey | NGXIFUDEPDQVJG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |