C10H13Cl2N3O — CID 103606420
3,6-dichloro-N-(3-methylbutyl)pyridazine-4-carboxamide (PubChem CID 103606420) has the molecular formula C10H13Cl2N3O and a molecular weight of 262.14 g/mol. Its IUPAC name is 3,6-dichloro-N-(3-methylbutyl)pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-(3-methylbutyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 103606420 |
| Molecular Formula | C10H13Cl2N3O |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 3,6-dichloro-N-(3-methylbutyl)pyridazine-4-carboxamide |
| SMILES | CC(C)CCNC(=O)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C10H13Cl2N3O/c1-6(2)3-4-13-10(16)7-5-8(11)14-15-9(7)12/h5-6H,3-4H2,1-2H3,(H,13,16) |
| InChIKey | LKQKCAYFAIAVNE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |