C8H9NOS — CID 59369604
CID 59369604 (PubChem CID 59369604) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol.
| Compound Name | CID 59369604 |
|---|---|
| PubChem CID | 59369604 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | — |
| SMILES | [CH]c1csc(C(=O)NCC)c1 |
| InChI | InChI=1S/C8H9NOS/c1-3-9-8(10)7-4-6(2)5-11-7/h2,4-5H,3H2,1H3,(H,9,10) |
| InChIKey | SIMYGNYPFRSRQH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |