C10H11ClN2O2S — CID 142921900
[C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate (PubChem CID 142921900) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate.
| Compound Name | [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate |
|---|---|
| PubChem CID | 142921900 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate |
| SMILES | CCC(=O)O/C(=N\C1CC1)c1cc(Cl)ns1 |
| InChI | InChI=1S/C10H11ClN2O2S/c1-2-9(14)15-10(12-6-3-4-6)7-5-8(11)13-16-7/h5-6H,2-4H2,1H3/b12-10- |
| InChIKey | RKDLFMYIUSUEEX-BENRWUELSA-N |
| XLogP | 2.66 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|