About [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate
[C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate (PubChem CID 142921900) has the molecular formula C10H11ClN2O2S
and a molecular weight of 258.73 g/mol. Its IUPAC name is [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate.
Molecular Properties
| Compound Name | [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate |
| PubChem CID | 142921900 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate |
| SMILES | CCC(=O)O/C(=N\C1CC1)c1cc(Cl)ns1 |
| InChI | InChI=1S/C10H11ClN2O2S/c1-2-9(14)15-10(12-6-3-4-6)7-5-8(11)13-16-7/h5-6H,2-4H2,1H3/b12-10- |
| InChIKey | RKDLFMYIUSUEEX-BENRWUELSA-N |
| XLogP | 2.66 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate?
The IUPAC name of [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate (CID 142921900) is [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate.
What is the SMILES notation for [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate?
The canonical SMILES for [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate is CCC(=O)O/C(=N\C1CC1)c1cc(Cl)ns1.
What is the InChIKey of [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate?
The InChIKey is RKDLFMYIUSUEEX-BENRWUELSA-N. The full InChI is InChI=1S/C10H11ClN2O2S/c1-2-9(14)15-10(12-6-3-4-6)7-5-8(11)13-16-7/h5-6H,2-4H2,1H3/b12-10-.
What are the key properties of [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate?
[C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate has a molecular weight of 258.73 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [C-(3-chloro-1,2-thiazol-5-yl)-N-cyclopropylcarbonimidoyl] propanoate is sourced from PubChem (CID 142921900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).