C14H19F3N2OS — CID 103505948
1-[3-amino-4-cyclopropyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]propan-1-one (PubChem CID 103505948) has the molecular formula C14H19F3N2OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 1-[3-amino-4-cyclopropyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]propan-1-one.
| Compound Name | 1-[3-amino-4-cyclopropyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]propan-1-one |
|---|---|
| PubChem CID | 103505948 |
| Molecular Formula | C14H19F3N2OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-[3-amino-4-cyclopropyl-5-(4,4,4-trifluorobutylamino)thiophen-2-yl]propan-1-one |
| SMILES | CCC(=O)c1sc(NCCCC(F)(F)F)c(C2CC2)c1N |
| InChI | InChI=1S/C14H19F3N2OS/c1-2-9(20)12-11(18)10(8-4-5-8)13(21-12)19-7-3-6-14(15,16)17/h8,19H,2-7,18H2,1H3 |
| InChIKey | QEFLIEUQWZEQOK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|