C12H16N4O2S — CID 103507819
ethyl 3-amino-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxylate (PubChem CID 103507819) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is ethyl 3-amino-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103507819 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | ethyl 3-amino-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NCc2cnn(C)c2)cc1N |
| InChI | InChI=1S/C12H16N4O2S/c1-3-18-12(17)11-9(13)4-10(19-11)14-5-8-6-15-16(2)7-8/h4,6-7,14H,3,5,13H2,1-2H3 |
| InChIKey | RDCWQSFINOWXAE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |