C12H15N5O2S2 — CID 103507833
3-amino-4-ethylsulfonyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carbonitrile (PubChem CID 103507833) has the molecular formula C12H15N5O2S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-amino-4-ethylsulfonyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-ethylsulfonyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103507833 |
| Molecular Formula | C12H15N5O2S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-amino-4-ethylsulfonyl-5-[(1-methylpyrazol-4-yl)methylamino]thiophene-2-carbonitrile |
| SMILES | CCS(=O)(=O)c1c(NCc2cnn(C)c2)sc(C#N)c1N |
| InChI | InChI=1S/C12H15N5O2S2/c1-3-21(18,19)11-10(14)9(4-13)20-12(11)15-5-8-6-16-17(2)7-8/h6-7,15H,3,5,14H2,1-2H3 |
| InChIKey | GRZCZZXFZQVHBW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |