C14H15N5 — CID 103468799
5-amino-6-[ethyl(pyridin-2-ylmethyl)amino]pyridine-3-carbonitrile (PubChem CID 103468799) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 5-amino-6-[ethyl(pyridin-2-ylmethyl)amino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-[ethyl(pyridin-2-ylmethyl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103468799 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 5-amino-6-[ethyl(pyridin-2-ylmethyl)amino]pyridine-3-carbonitrile |
| SMILES | CCN(Cc1ccccn1)c1ncc(C#N)cc1N |
| InChI | InChI=1S/C14H15N5/c1-2-19(10-12-5-3-4-6-17-12)14-13(16)7-11(8-15)9-18-14/h3-7,9H,2,10,16H2,1H3 |
| InChIKey | NEOFTZDYWZTHNL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |