C14H16FN3OS — CID 103420742
3-amino-5-[(3-fluorophenyl)methyl-methylamino]-N-methylthiophene-2-carboxamide (PubChem CID 103420742) has the molecular formula C14H16FN3OS and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-amino-5-[(3-fluorophenyl)methyl-methylamino]-N-methylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(3-fluorophenyl)methyl-methylamino]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420742 |
| Molecular Formula | C14H16FN3OS |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3-amino-5-[(3-fluorophenyl)methyl-methylamino]-N-methylthiophene-2-carboxamide |
| SMILES | CNC(=O)c1sc(N(C)Cc2cccc(F)c2)cc1N |
| InChI | InChI=1S/C14H16FN3OS/c1-17-14(19)13-11(16)7-12(20-13)18(2)8-9-4-3-5-10(15)6-9/h3-7H,8,16H2,1-2H3,(H,17,19) |
| InChIKey | JJUOXXKROOPTRM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |