C12H18N4O3S2 — CID 103506802
3-amino-5-[(4-methylmorpholin-2-yl)methylamino]-4-methylsulfonylthiophene-2-carbonitrile (PubChem CID 103506802) has the molecular formula C12H18N4O3S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 3-amino-5-[(4-methylmorpholin-2-yl)methylamino]-4-methylsulfonylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[(4-methylmorpholin-2-yl)methylamino]-4-methylsulfonylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103506802 |
| Molecular Formula | C12H18N4O3S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-amino-5-[(4-methylmorpholin-2-yl)methylamino]-4-methylsulfonylthiophene-2-carbonitrile |
| SMILES | CN1CCOC(CNc2sc(C#N)c(N)c2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H18N4O3S2/c1-16-3-4-19-8(7-16)6-15-12-11(21(2,17)18)10(14)9(5-13)20-12/h8,15H,3-4,6-7,14H2,1-2H3 |
| InChIKey | VWVUSPLGMUAILL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |