C9H16N4O3S2 — CID 133280999
2-[(4-methylmorpholin-2-yl)methylamino]-1,3-thiazole-5-sulfonamide (PubChem CID 133280999) has the molecular formula C9H16N4O3S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-[(4-methylmorpholin-2-yl)methylamino]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[(4-methylmorpholin-2-yl)methylamino]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 133280999 |
| Molecular Formula | C9H16N4O3S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[(4-methylmorpholin-2-yl)methylamino]-1,3-thiazole-5-sulfonamide |
| SMILES | CN1CCOC(CNc2ncc(S(N)(=O)=O)s2)C1 |
| InChI | InChI=1S/C9H16N4O3S2/c1-13-2-3-16-7(6-13)4-11-9-12-5-8(17-9)18(10,14)15/h5,7H,2-4,6H2,1H3,(H,11,12)(H2,10,14,15) |
| InChIKey | XIMWZZZPDAAONX-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |