C10H16IN3OS — CID 124873009
N-[(5-iodo-1,3-thiazol-2-yl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine (PubChem CID 124873009) has the molecular formula C10H16IN3OS and a molecular weight of 353.23 g/mol. Its IUPAC name is N-[(5-iodo-1,3-thiazol-2-yl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine.
| Compound Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 124873009 |
| Molecular Formula | C10H16IN3OS |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine |
| SMILES | CN1CCO[C@H](CNCc2ncc(I)s2)C1 |
| InChI | InChI=1S/C10H16IN3OS/c1-14-2-3-15-8(7-14)4-12-6-10-13-5-9(11)16-10/h5,8,12H,2-4,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | DTPKRNVVLQBLKC-MRVPVSSYSA-N |
| XLogP | 1.17 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|