C12H20N2O3 — CID 79032869
[5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-yl]methanol (PubChem CID 79032869) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is [5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 79032869 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-yl]methanol |
| SMILES | CN1CCOC(CNCc2ccc(CO)o2)C1 |
| InChI | InChI=1S/C12H20N2O3/c1-14-4-5-16-12(8-14)7-13-6-10-2-3-11(9-15)17-10/h2-3,12-13,15H,4-9H2,1H3 |
| InChIKey | VVAWIOVFABZRGI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 57.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |