C13H20N2O3 — CID 79083126
3-[[(4-methylmorpholin-2-yl)methylamino]methyl]benzene-1,2-diol (PubChem CID 79083126) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-[[(4-methylmorpholin-2-yl)methylamino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[(4-methylmorpholin-2-yl)methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 79083126 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-[[(4-methylmorpholin-2-yl)methylamino]methyl]benzene-1,2-diol |
| SMILES | CN1CCOC(CNCc2cccc(O)c2O)C1 |
| InChI | InChI=1S/C13H20N2O3/c1-15-5-6-18-11(9-15)8-14-7-10-3-2-4-12(16)13(10)17/h2-4,11,14,16-17H,5-9H2,1H3 |
| InChIKey | XZCIQZOFRKOCCT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|