C13H18BrFN2O — CID 95758037
N-[(2-bromo-4-fluorophenyl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine (PubChem CID 95758037) has the molecular formula C13H18BrFN2O and a molecular weight of 317.20 g/mol. Its IUPAC name is N-[(2-bromo-4-fluorophenyl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine.
| Compound Name | N-[(2-bromo-4-fluorophenyl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 95758037 |
| Molecular Formula | C13H18BrFN2O |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-[(2-bromo-4-fluorophenyl)methyl]-1-[(2R)-4-methylmorpholin-2-yl]methanamine |
| SMILES | CN1CCO[C@H](CNCc2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C13H18BrFN2O/c1-17-4-5-18-12(9-17)8-16-7-10-2-3-11(15)6-13(10)14/h2-3,6,12,16H,4-5,7-9H2,1H3/t12-/m1/s1 |
| InChIKey | KFWKUYGHFBNUEV-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |