C13H20N2O4 — CID 103255451
3-methyl-5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-carboxylic acid (PubChem CID 103255451) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-methyl-5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 3-methyl-5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 103255451 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-methyl-5-[[(4-methylmorpholin-2-yl)methylamino]methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(CNCC2CN(C)CCO2)oc1C(=O)O |
| InChI | InChI=1S/C13H20N2O4/c1-9-5-10(19-12(9)13(16)17)6-14-7-11-8-15(2)3-4-18-11/h5,11,14H,3-4,6-8H2,1-2H3,(H,16,17) |
| InChIKey | NHVOXRZESASLGY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |