C20H23NO6S — CID 7765152
diethyl 5-amino-3-[(2,3-dimethylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 7765152) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is diethyl 5-amino-3-[(2,3-dimethylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-amino-3-[(2,3-dimethylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7765152 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | diethyl 5-amino-3-[(2,3-dimethylbenzoyl)oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OCC)c1COC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C20H23NO6S/c1-5-25-19(23)15-14(16(28-17(15)21)20(24)26-6-2)10-27-18(22)13-9-7-8-11(3)12(13)4/h7-9H,5-6,10,21H2,1-4H3 |
| InChIKey | KTGCKCVBTBWQIL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|